CAS 4497-61-4 is the registry number for 2,2,4,8-Tetramethyl-1,2,3,4-tetrahydroquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2,2,4,8-tetramethyl-3,4-dihydro-1H-quinoline (CAS 4497-61-4) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: 2,2,4,8-tetramethyl-3,4-dihydro-1H-quinoline. InChIKey: QCPHCTXGGHZXHS-UHFFFAOYSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 2,2,4,8-tetramethyl-3,4-dihydro-1H-quinoline |
| InChIKey | QCPHCTXGGHZXHS-UHFFFAOYSA-N |
| SMILES | CC1CC(NC2=C(C=CC=C12)C)(C)C |
Computed by PubChem (NCBI)