CAS 449758-80-9 is the registry number for 5-Fluoro-2-(1h-1,2,4-triazol-1-yl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-fluoro-2-(1,2,4-triazol-1-yl)benzonitrile (CAS 449758-80-9) is a chemical compound with the molecular formula C9H5FN4 and a molecular weight of 188.16 g/mol. IUPAC name: 5-fluoro-2-(1,2,4-triazol-1-yl)benzonitrile. InChIKey: DYXLXGFQGXDUFN-UHFFFAOYSA-N.
| Molecular formula | C9H5FN4 |
|---|---|
| Molecular weight | 188.16 g/mol |
| IUPAC name | 5-fluoro-2-(1,2,4-triazol-1-yl)benzonitrile |
| InChIKey | DYXLXGFQGXDUFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C#N)N2C=NC=N2 |
Computed by PubChem (NCBI)