CAS 449778-74-9 is the registry number for 2-[3-Methyl-5-(trifluoromethyl)-1h-pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid (CAS 449778-74-9) is a chemical compound with the molecular formula C9H6F3N3O2S and a molecular weight of 277.23 g/mol. IUPAC name: 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid. InChIKey: FIHDHYCDPQIHTA-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O2S |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | FIHDHYCDPQIHTA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(F)(F)F)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)