CAS 4499-40-5 appears in our catalog under these names: Oxytrimethylline, Choline theophyllinate/ 98%, Oxtriphylline, Oxtriphylline, ≥98%, ≥98%, Choline theophyllinate (Standard). Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 2,5g, 5mg, 10mg, 100mg, 50mg, 500mg, 5000mg, 1000mg.
1,3-dimethyl-2-oxopurin-6-olate;2-hydroxyethyl(trimethyl)azanium (CAS 4499-40-5) is a chemical compound with the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. IUPAC name: 1,3-dimethyl-2-oxopurin-6-olate;2-hydroxyethyl(trimethyl)azanium. InChIKey: SOELXOBIIIBLRJ-UHFFFAOYSA-M.
| Molecular formula | C12H21N5O3 |
|---|---|
| Molecular weight | 283.33 g/mol |
| IUPAC name | 1,3-dimethyl-2-oxopurin-6-olate;2-hydroxyethyl(trimethyl)azanium |
| InChIKey | SOELXOBIIIBLRJ-UHFFFAOYSA-M |
| SMILES | CN1C(=C2C(=NC=N2)N(C1=O)C)[O-].C[N+](C)(C)CCO |
Computed by PubChem (NCBI)