CAS 4504-88-5 appears in our catalog under these names: Doxepin EP Impurity B, Doxepin Impurity 2(Doxepin EP Impurity B), 11-(3-(Dimethylamino)propyl)-6,11-dihydrocibenz(b,e)oxepin-11-ol, >95% (HPLC), (11RS)-11-(3-(Dimethylamino)-propyl)-6,11-dihydrodibenzo(b,e)oxepin-11-ol (Doxepinol), 11-(3-(Dimethylamino)propyl)-6,11-dihydrodibenz(b,e)oxepin-11-ol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
11-[3-(dimethylamino)propyl]-6H-benzo[c][1]benzoxepin-11-ol (CAS 4504-88-5) is a chemical compound with the molecular formula C19H23NO2 and a molecular weight of 297.4 g/mol. IUPAC name: 11-[3-(dimethylamino)propyl]-6H-benzo[c][1]benzoxepin-11-ol. InChIKey: ZEKLFUWSVQYTOO-UHFFFAOYSA-N.
| Molecular formula | C19H23NO2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 11-[3-(dimethylamino)propyl]-6H-benzo[c][1]benzoxepin-11-ol |
| InChIKey | ZEKLFUWSVQYTOO-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=CC=CC=C2COC3=CC=CC=C31)O |
Computed by PubChem (NCBI)