Products 450409-87-7
CAS 450409-87-7 is the registry number for 3,5-Bis(trifluoromethyl)phenylsulfonylethanol, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethanol (CAS 450409-87-7) is a chemical compound with the molecular formula C10H8F6O3S and a molecular weight of 322.23 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethanol. InChIKey: QGINSQDXMKHIOR-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O3S |
|---|---|
| Molecular weight | 322.23 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethanol |
| InChIKey | QGINSQDXMKHIOR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)CCO)C(F)(F)F |
Computed by PubChem (NCBI)