CAS 450841-30-2 is the registry number for 5-Bromo-1,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-1,6-dimethyl-2-oxopyridine-3-carbonitrile (CAS 450841-30-2) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 5-bromo-1,6-dimethyl-2-oxopyridine-3-carbonitrile. InChIKey: JQTOEFNGSMKRJB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 5-bromo-1,6-dimethyl-2-oxopyridine-3-carbonitrile |
| InChIKey | JQTOEFNGSMKRJB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1C)C#N)Br |
Computed by PubChem (NCBI)