Products 4513-93-3

CAS 4513-93-3 appears in our catalog under these names: 3,5–Dimethyl–1H–pyrrole–2–carboxylic acid, 3,5-Dimethyl-1H-pyrrole-2-carboxylic acid, 97%, 97%, 3,5-Dimethylpyrrole-2-carboxylic acid, 95%, 3,5-Dimethyl-1H-pyrrole-2-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3,5-dimethyl-1H-pyrrole-2-carboxylic acid (CAS 4513-93-3) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. IUPAC name: 3,5-dimethyl-1H-pyrrole-2-carboxylic acid. InChIKey: XQGVQRPSTODODM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO2
Molecular weight139.15 g/mol
IUPAC name3,5-dimethyl-1H-pyrrole-2-carboxylic acid
InChIKeyXQGVQRPSTODODM-UHFFFAOYSA-N
SMILESCC1=CC(=C(N1)C(=O)O)C

Computed by PubChem (NCBI)