CAS 451466-81-2 is the registry number for (8R)-5,6,7,8-Tetrahydroquinolin-8-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(8R)-5,6,7,8-tetrahydroquinolin-8-ol (CAS 451466-81-2) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (8R)-5,6,7,8-tetrahydroquinolin-8-ol. InChIKey: YCQHYOBSOVFBEB-MRVPVSSYSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (8R)-5,6,7,8-tetrahydroquinolin-8-ol |
| InChIKey | YCQHYOBSOVFBEB-MRVPVSSYSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=CC=N2)O |
Computed by PubChem (NCBI)