CAS 451494-34-1 appears in our catalog under these names: 7-Bromo-6-nitroquinazolin-4(3H)-one, 97%, 7-Bromo-6-nitro-3,4-dihydroquinazolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
7-bromo-6-nitro-3H-quinazolin-4-one (CAS 451494-34-1) is a chemical compound with the molecular formula C8H4BrN3O3 and a molecular weight of 270.04 g/mol. IUPAC name: 7-bromo-6-nitro-3H-quinazolin-4-one. InChIKey: HTNGXJGVBZFNIN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrN3O3 |
|---|---|
| Molecular weight | 270.04 g/mol |
| IUPAC name | 7-bromo-6-nitro-3H-quinazolin-4-one |
| InChIKey | HTNGXJGVBZFNIN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1[N+](=O)[O-])Br)N=CNC2=O |
Computed by PubChem (NCBI)