CAS 451503-30-3 appears in our catalog under these names: (S)-(4-Bromophenyl)(phenyl)methanamine hydrochloride, 95%, (S)–(4–Bromophenyl)(phenyl)methanamine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(S)-(4-bromophenyl)-phenylmethanamine;hydrochloride (CAS 451503-30-3) is a chemical compound with the molecular formula C13H13BrClN and a molecular weight of 298.60 g/mol. IUPAC name: (S)-(4-bromophenyl)-phenylmethanamine;hydrochloride. InChIKey: SZWHELGYDLPWLM-ZOWNYOTGSA-N.
| Molecular formula | C13H13BrClN |
|---|---|
| Molecular weight | 298.60 g/mol |
| IUPAC name | (S)-(4-bromophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | SZWHELGYDLPWLM-ZOWNYOTGSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C2=CC=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)