Products 451516-79-3
CAS 451516-79-3 is the registry number for Topoisomerase II inhibitor 15. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3,4-dichlorophenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (CAS 451516-79-3) is a chemical compound with the molecular formula C15H11Cl2N5 and a molecular weight of 332.2 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine. InChIKey: ZDSMMZLZVFAZGS-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2N5 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| InChIKey | ZDSMMZLZVFAZGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(N=C(N3)N)C4=CC(=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Topoisomerase II inhibitor 15, orb2277895