Products 45164-27-0

CAS 45164-27-0 is the registry number for 9-Hydroxy-4,7-diaza-nonyl Phosphate. Offered by: TRC. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

3-[2-(2-hydroxyethylamino)ethylamino]propyl dihydrogen phosphate (CAS 45164-27-0) is a chemical compound with the molecular formula C7H19N2O5P and a molecular weight of 242.21 g/mol. IUPAC name: 3-[2-(2-hydroxyethylamino)ethylamino]propyl dihydrogen phosphate. InChIKey: NAVOCVSWUIVXAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H19N2O5P
Molecular weight242.21 g/mol
IUPAC name3-[2-(2-hydroxyethylamino)ethylamino]propyl dihydrogen phosphate
InChIKeyNAVOCVSWUIVXAQ-UHFFFAOYSA-N
SMILESC(CNCCNCCO)COP(=O)(O)O

Computed by PubChem (NCBI)