Products 452072-24-1
CAS 452072-24-1 is the registry number for Sulfo-SPP (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 2,5-dioxo-1-[4-(pyridin-2-yldisulfanyl)pentanoyloxy]pyrrolidine-3-sulfonate (CAS 452072-24-1) is a chemical compound with the molecular formula C14H15N2NaO7S3 and a molecular weight of 442.5 g/mol. IUPAC name: sodium 2,5-dioxo-1-[4-(pyridin-2-yldisulfanyl)pentanoyloxy]pyrrolidine-3-sulfonate. InChIKey: BBEYHTSOUCPSMC-UHFFFAOYSA-M.
| Molecular formula | C14H15N2NaO7S3 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | sodium 2,5-dioxo-1-[4-(pyridin-2-yldisulfanyl)pentanoyloxy]pyrrolidine-3-sulfonate |
| InChIKey | BBEYHTSOUCPSMC-UHFFFAOYSA-M |
| SMILES | CC(CCC(=O)ON1C(=O)CC(C1=O)S(=O)(=O)[O-])SSC2=CC=CC=N2.[Na+] |
Computed by PubChem (NCBI)