CAS 452304-63-1 is the registry number for (1S,2S)-2-(Diphenylphosphino)cyclohexanamine, 98%. Offered by: AmBeed. Available pack sizes: 100mg.
Trans-(1S,2S)-2-diphenylphosphanylcyclohexan-1-amine (CAS 452304-63-1) is a chemical compound with the molecular formula C18H22NP and a molecular weight of 283.3 g/mol. IUPAC name: trans-(1S,2S)-2-diphenylphosphanylcyclohexan-1-amine. InChIKey: ZATLZEHZPXYMFE-ROUUACIJSA-N.
| Molecular formula | C18H22NP |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | trans-(1S,2S)-2-diphenylphosphanylcyclohexan-1-amine |
| InChIKey | ZATLZEHZPXYMFE-ROUUACIJSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)P(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)