CAS 452319-21-0 is the registry number for 2-Oxo-2-(((tetrahydrofuran-2-yl)methyl)amino)ethyl 5-nitrofuran-2-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 5-nitrofuran-2-carboxylate (CAS 452319-21-0) is a chemical compound with the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. IUPAC name: [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 5-nitrofuran-2-carboxylate. InChIKey: ZHONJLIWJDULBP-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O7 |
|---|---|
| Molecular weight | 298.25 g/mol |
| IUPAC name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 5-nitrofuran-2-carboxylate |
| InChIKey | ZHONJLIWJDULBP-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNC(=O)COC(=O)C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)