CAS 452340-96-4 appears in our catalog under these names: Vilanterol Impurity 21, Vilanterol Impurity 24, 5-(2,2-Dimethyl-4H-1,3-benzo(d)(1,3)dioxin-6-yl)oxazolidin-2-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one (CAS 452340-96-4) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: 5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one. InChIKey: JUEBDVANOFZMMX-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one |
| InChIKey | JUEBDVANOFZMMX-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)C3CNC(=O)O3)C |
Computed by PubChem (NCBI)