CAS 4524-78-1 appears in our catalog under these names: 6-Bromo-2,4,5-trichlorophenol, 95%, 3,4,6-Trichloro-2-nitrophenol, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-bromo-3,4,6-trichlorophenol (CAS 4524-78-1) is a chemical compound with the molecular formula C6H2BrCl3O and a molecular weight of 276.3 g/mol. IUPAC name: 2-bromo-3,4,6-trichlorophenol. InChIKey: IFXJBIXHNZHYGK-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 2-bromo-3,4,6-trichlorophenol |
| InChIKey | IFXJBIXHNZHYGK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Br)O)Cl |
Computed by PubChem (NCBI)