CAS 4525-46-6 appears in our catalog under these names: Benzyltrimethylammonium iodide, 98%, N,N,N-Trimethyl-1-phenylmethanaminium iodide, 95%, 95%, N,N,N-Trimethyl-1-phenylmethanaminium iodide, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g.
Benzyl(trimethyl)azanium iodide (CAS 4525-46-6) is a chemical compound with the molecular formula C10H16IN and a molecular weight of 277.14 g/mol. IUPAC name: benzyl(trimethyl)azanium iodide. InChIKey: LRRJQNMXIDXNIM-UHFFFAOYSA-M.
| Molecular formula | C10H16IN |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | benzyl(trimethyl)azanium iodide |
| InChIKey | LRRJQNMXIDXNIM-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC1=CC=CC=C1.[I-] |
Computed by PubChem (NCBI)