CAS 452905-58-7 is the registry number for 2,3,4,5,6-Pentafluorophenyl 1-ethylenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,3,4,5,6-pentafluorophenyl) ethenesulfonate (CAS 452905-58-7) is a chemical compound with the molecular formula C8H3F5O3S and a molecular weight of 274.17 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) ethenesulfonate. InChIKey: NVXWLLDJCHOIBZ-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O3S |
|---|---|
| Molecular weight | 274.17 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) ethenesulfonate |
| InChIKey | NVXWLLDJCHOIBZ-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)OC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)