CAS 453-54-3 is the registry number for (4-chloro-3-(trifluoromethyl)phenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[4-chloro-3-(trifluoromethyl)phenyl]-trimethylsilane (CAS 453-54-3) is a chemical compound with the molecular formula C10H12ClF3Si and a molecular weight of 252.73 g/mol. IUPAC name: [4-chloro-3-(trifluoromethyl)phenyl]-trimethylsilane. InChIKey: HMQOINFOCYQETP-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF3Si |
|---|---|
| Molecular weight | 252.73 g/mol |
| IUPAC name | [4-chloro-3-(trifluoromethyl)phenyl]-trimethylsilane |
| InChIKey | HMQOINFOCYQETP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)