CAS 4531-53-7 is the registry number for 5-Chloro-1-methylimidazole nitrate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
5-chloro-1-methylimidazole;nitric acid (CAS 4531-53-7) is a chemical compound with the molecular formula C4H6ClN3O3 and a molecular weight of 179.56 g/mol. IUPAC name: 5-chloro-1-methylimidazole;nitric acid. InChIKey: PPAZZUWYNLCOAK-UHFFFAOYSA-N.
| Molecular formula | C4H6ClN3O3 |
|---|---|
| Molecular weight | 179.56 g/mol |
| IUPAC name | 5-chloro-1-methylimidazole;nitric acid |
| InChIKey | PPAZZUWYNLCOAK-UHFFFAOYSA-N |
| SMILES | CN1C=NC=C1Cl.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)