Products 4531-53-7

CAS 4531-53-7 is the registry number for 5-Chloro-1-methylimidazole nitrate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-chloro-1-methylimidazole;nitric acid (CAS 4531-53-7) is a chemical compound with the molecular formula C4H6ClN3O3 and a molecular weight of 179.56 g/mol. IUPAC name: 5-chloro-1-methylimidazole;nitric acid. InChIKey: PPAZZUWYNLCOAK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6ClN3O3
Molecular weight179.56 g/mol
IUPAC name5-chloro-1-methylimidazole;nitric acid
InChIKeyPPAZZUWYNLCOAK-UHFFFAOYSA-N
SMILESCN1C=NC=C1Cl.[N+](=O)(O)[O-]

Computed by PubChem (NCBI)