CAS 453568-86-0 is the registry number for 3-(2-(Pyridin-2-yl)oxazol-4-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-pyridin-2-yl-1,3-oxazol-4-yl)benzonitrile (CAS 453568-86-0) is a chemical compound with the molecular formula C15H9N3O and a molecular weight of 247.25 g/mol. IUPAC name: 3-(2-pyridin-2-yl-1,3-oxazol-4-yl)benzonitrile. InChIKey: ULNTYAXLHKONNQ-UHFFFAOYSA-N.
| Molecular formula | C15H9N3O |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 3-(2-pyridin-2-yl-1,3-oxazol-4-yl)benzonitrile |
| InChIKey | ULNTYAXLHKONNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=CO2)C3=CC=CC(=C3)C#N |
Computed by PubChem (NCBI)