Products 4541-43-9

CAS 4541-43-9 is the registry number for rac-(1R,2R)-2-Methylcyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-methylcyclopentane-1-carboxylic acid (CAS 4541-43-9) is a chemical compound with the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. IUPAC name: trans-(1R,2R)-2-methylcyclopentane-1-carboxylic acid. InChIKey: YDUMDNFZGQAOJB-PHDIDXHHSA-N.

Identity
Molecular formulaC7H12O2
Molecular weight128.17 g/mol
IUPAC nametrans-(1R,2R)-2-methylcyclopentane-1-carboxylic acid
InChIKeyYDUMDNFZGQAOJB-PHDIDXHHSA-N
SMILESC[C@@H]1CCC[C@H]1C(=O)O

Computed by PubChem (NCBI)