Products 454203-25-9
CAS 454203-25-9 is the registry number for ACAT-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-amino-2,6-dimethoxyphenyl) N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate (CAS 454203-25-9) is a chemical compound with the molecular formula C25H36N2O6S and a molecular weight of 492.6 g/mol. IUPAC name: (4-amino-2,6-dimethoxyphenyl) N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate. InChIKey: NFURJPGPYLCLIT-UHFFFAOYSA-N.
| Molecular formula | C25H36N2O6S |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | (4-amino-2,6-dimethoxyphenyl) N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate |
| InChIKey | NFURJPGPYLCLIT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)CC(=O)NS(=O)(=O)OC2=C(C=C(C=C2OC)N)OC)C(C)C |
Computed by PubChem (NCBI)