CAS 4543-33-3 appears in our catalog under these names: 1,3,6,8-Tetranitrocarbazole, 97%, 1,3,6,8–Tetranitrocarbazole, 1,3,6,8-Tetranitro-9H-carbazole. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 25g, 5g, 100mg.
1,3,6,8-tetranitro-9H-carbazole (CAS 4543-33-3) is a chemical compound with the molecular formula C12H5N5O8 and a molecular weight of 347.20 g/mol. IUPAC name: 1,3,6,8-tetranitro-9H-carbazole. InChIKey: JUSWGNJYSBSOFM-UHFFFAOYSA-N.
| Molecular formula | C12H5N5O8 |
|---|---|
| Molecular weight | 347.20 g/mol |
| IUPAC name | 1,3,6,8-tetranitro-9H-carbazole |
| InChIKey | JUSWGNJYSBSOFM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C3=C(N2)C(=CC(=C3)[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)