CAS 454431-03-9 is the registry number for (6-Methoxynaphthalen-2-ylethynyl)trimethylsilane, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(6-methoxynaphthalen-2-yl)ethynyl-trimethylsilane (CAS 454431-03-9) is a chemical compound with the molecular formula C16H18OSi and a molecular weight of 254.40 g/mol. IUPAC name: 2-(6-methoxynaphthalen-2-yl)ethynyl-trimethylsilane. InChIKey: CIRBLQJTKYVIDP-UHFFFAOYSA-N.
| Molecular formula | C16H18OSi |
|---|---|
| Molecular weight | 254.40 g/mol |
| IUPAC name | 2-(6-methoxynaphthalen-2-yl)ethynyl-trimethylsilane |
| InChIKey | CIRBLQJTKYVIDP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C#C[Si](C)(C)C |
Computed by PubChem (NCBI)