CAS 454713-47-4 is the registry number for N-Boc-1-bromo-2-naphthalenamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
Tert-butyl N-(1-bromonaphthalen-2-yl)carbamate (CAS 454713-47-4) is a chemical compound with the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. IUPAC name: tert-butyl N-(1-bromonaphthalen-2-yl)carbamate. InChIKey: JUHUGHMRVYRVEL-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO2 |
|---|---|
| Molecular weight | 322.20 g/mol |
| IUPAC name | tert-butyl N-(1-bromonaphthalen-2-yl)carbamate |
| InChIKey | JUHUGHMRVYRVEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C2=CC=CC=C2C=C1)Br |
Computed by PubChem (NCBI)