CAS 455-17-4 appears in our catalog under these names: (4-Fluorophenyl)trimethylsilane 95+%, 1-Fluoro-4-(trimethylsilyl)benzene, 95%, p-Fluorophenyltrimethylsilane, 95%. Offered by: Ambeed, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
(4-fluorophenyl)-trimethylsilane (CAS 455-17-4) is a chemical compound with the molecular formula C9H13FSi and a molecular weight of 168.28 g/mol. IUPAC name: (4-fluorophenyl)-trimethylsilane. InChIKey: VZKFVPRKXHZBQO-UHFFFAOYSA-N.
| Molecular formula | C9H13FSi |
|---|---|
| Molecular weight | 168.28 g/mol |
| IUPAC name | (4-fluorophenyl)-trimethylsilane |
| InChIKey | VZKFVPRKXHZBQO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)