Products 455-31-2
CAS 455-31-2 appears in our catalog under these names: (Difluoromethyl)benzene, 98%, (Difluoromethyl)benzene, (Difluoromethyl)benzene, >98.0%(GC), (Difluoromethyl)benzene 97%, (DIFLUOROMETHYL)BENZENE, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 200mg, 250mg.
Difluoromethylbenzene (CAS 455-31-2) is a chemical compound with the molecular formula C7H6F2 and a molecular weight of 128.12 g/mol. IUPAC name: difluoromethylbenzene. InChIKey: JDZLOJYSBBLXQD-UHFFFAOYSA-N.
| Molecular formula | C7H6F2 |
|---|---|
| Molecular weight | 128.12 g/mol |
| IUPAC name | difluoromethylbenzene |
| InChIKey | JDZLOJYSBBLXQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(F)F |
Computed by PubChem (NCBI)
Synonyms:
(difluoromethyl)benzene, benzene, (difluoromethyl)-, InChI=1/C7H6F2/c8-7(9)6-4-2-1-3-5-6/h1-5,7, difluoromethylbenzene, alpha,alpha-difluorotoluene, Benzalfluorid, a,a-difluorotoluene, difluoromethyl-benzene, (Difluoromethyl)benzene, 97%, Difluoromethylbenzene, stabilized over potassium carbonate