CAS 455-93-6 appears in our catalog under these names: 2-Fluoro-4-nitroanisole, 98%, 2–Fluoro–4–nitroanisole, 2-Fluoro-4-nitroanisole, >98.0%(GC), 2-Fluoro-4-nitroanisole 98+%, 2-Fluoro-4-nitroanisole, 98%, 98%. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 1000g, 500g, 10g, 50g.
2-fluoro-1-methoxy-4-nitrobenzene (CAS 455-93-6) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 2-fluoro-1-methoxy-4-nitrobenzene. InChIKey: XGMVTXUXZUPGGY-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 2-fluoro-1-methoxy-4-nitrobenzene |
| InChIKey | XGMVTXUXZUPGGY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)