Products 45503-33-1
CAS 45503-33-1 appears in our catalog under these names: 4-Hydroxypyridine-d5, 98 atom % D, min 98% Chemical Purity, Pyridin-4-ol-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
2,3,5,6-tetradeuterio-4-deuteriooxypyridine (CAS 45503-33-1) is a chemical compound with the molecular formula C5H5NO and a molecular weight of 100.13 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-deuteriooxypyridine. InChIKey: GCNTZFIIOFTKIY-HXRFYODMSA-N.
| Molecular formula | C5H5NO |
|---|---|
| Molecular weight | 100.13 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-deuteriooxypyridine |
| InChIKey | GCNTZFIIOFTKIY-HXRFYODMSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1O[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)