CAS 4563-84-2 appears in our catalog under these names: Sodium sulfamethoxazole, 95%, Sulfamethoxazole sodium/ 100%, Sulfamethoxazole sodium, Sulfamethoxazole sodium salt, 95.00%, Sulfamethoxazole sodium 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg, 200mg, 500mg, 25g.
Sodium (4-aminophenyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide (CAS 4563-84-2) is a chemical compound with the molecular formula C10H10N3NaO3S and a molecular weight of 275.26 g/mol. IUPAC name: sodium (4-aminophenyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide. InChIKey: LARLNXOUTTUXPN-UHFFFAOYSA-N.
| Molecular formula | C10H10N3NaO3S |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | sodium (4-aminophenyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide |
| InChIKey | LARLNXOUTTUXPN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Na+] |
Computed by PubChem (NCBI)