CAS 4566-64-7 is the registry number for 2,4,6-Tri-tert-butyl-n-methylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,4,6-tritert-butyl-N-methylaniline (CAS 4566-64-7) is a chemical compound with the molecular formula C19H33N and a molecular weight of 275.5 g/mol. IUPAC name: 2,4,6-tritert-butyl-N-methylaniline. InChIKey: GFTNLYGZUUPSSM-UHFFFAOYSA-N.
| Molecular formula | C19H33N |
|---|---|
| Molecular weight | 275.5 g/mol |
| IUPAC name | 2,4,6-tritert-butyl-N-methylaniline |
| InChIKey | GFTNLYGZUUPSSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)NC)C(C)(C)C |
Computed by PubChem (NCBI)