Products 4569-88-4
CAS 4569-88-4 is the registry number for Indoine Blue. Offered by: Biosynth, Thermo Scientific (Acros), MedChemExpress. Available pack sizes: 5g, 10g, 1g, 25g, 100g, 50g, Get quote.
1-[(8-amino-3,7-dimethyl-10-phenylphenazin-10-ium-2-yl)diazenyl]naphthalen-2-ol chloride (CAS 4569-88-4) is a chemical compound with the molecular formula C30H24ClN5O and a molecular weight of 506.0 g/mol. IUPAC name: 1-[(8-amino-3,7-dimethyl-10-phenylphenazin-10-ium-2-yl)diazenyl]naphthalen-2-ol chloride. InChIKey: SCMDRBZEIUMBBQ-UHFFFAOYSA-N.
| Molecular formula | C30H24ClN5O |
|---|---|
| Molecular weight | 506.0 g/mol |
| IUPAC name | 1-[(8-amino-3,7-dimethyl-10-phenylphenazin-10-ium-2-yl)diazenyl]naphthalen-2-ol chloride |
| InChIKey | SCMDRBZEIUMBBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1N)[N+](=C3C=C(C(=CC3=N2)C)N=NC4=C(C=CC5=CC=CC=C54)O)C6=CC=CC=C6.[Cl-] |
Computed by PubChem (NCBI)