CAS 457081-03-7 appears in our catalog under these names: Pyridone 6, Pyridone 6/ 98.7% (existing batch purity), Pyridone 6, Merck-5, Pyridone 6 98%. Offered by: TRC, TargetMol, GLPBio, Chemat, Ambeed. Available pack sizes: 0,5mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
4-tert-butyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (CAS 457081-03-7) is a chemical compound with the molecular formula C18H16FN3O and a molecular weight of 309.3 g/mol. IUPAC name: 4-tert-butyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one. InChIKey: VNDWQCSOSCCWIP-UHFFFAOYSA-N.
| Molecular formula | C18H16FN3O |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 4-tert-butyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| InChIKey | VNDWQCSOSCCWIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(N1)C3=C(C=C(C=C3)F)C4=C2C=CNC4=O |
Computed by PubChem (NCBI)