Products 45725-47-1

CAS 45725-47-1 is the registry number for Collidine-hydrogen Fluoride Complex (approx 1:2 collidine:HF). Offered by: TRC. Available pack sizes: 2,5g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

2,4,6-trimethylpyridine;hydrofluoride (CAS 45725-47-1) is a chemical compound with the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. IUPAC name: 2,4,6-trimethylpyridine;hydrofluoride. InChIKey: IDKGEEJHKVNSCI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12FN
Molecular weight141.19 g/mol
IUPAC name2,4,6-trimethylpyridine;hydrofluoride
InChIKeyIDKGEEJHKVNSCI-UHFFFAOYSA-N
SMILESCC1=CC(=NC(=C1)C)C.F

Computed by PubChem (NCBI)