CAS 45738-97-4 appears in our catalog under these names: 1,2,3,9-Tetrahydro-6H-purin-6-one sodium salt, 97%, 97%, Hypoxanthine monosodium salt, 250 g, Hypoxanthine Monosodium Salt, >95% (HPLC), Hypoxanthine monosodium salt, Sodium 6-oxo-3,6-dihydropurin-7-ide 97%. Offered by: Chemat, Roth, TRC, Biosynth, Ambeed. Available pack sizes: 500g, 1g, 5g, 25g, 100g, 250g, 2,5g, 50g.
Sodium 7H-purin-6-olate (CAS 45738-97-4) is a chemical compound with the molecular formula C5H3N4NaO and a molecular weight of 158.09 g/mol. IUPAC name: sodium 7H-purin-6-olate. InChIKey: KSQGJUORFCVRTI-UHFFFAOYSA-M.
| Molecular formula | C5H3N4NaO |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | sodium 7H-purin-6-olate |
| InChIKey | KSQGJUORFCVRTI-UHFFFAOYSA-M |
| SMILES | C1=NC2=C(N1)C(=NC=N2)[O-].[Na+] |
Computed by PubChem (NCBI)