Products 45750-74-1

CAS 45750-74-1 is the registry number for Pralidoxime Chloride Impurity 3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-methylpyridin-1-ium-2-carboxamide (CAS 45750-74-1) is a chemical compound with the molecular formula C7H9N2O+ and a molecular weight of 137.16 g/mol. IUPAC name: 1-methylpyridin-1-ium-2-carboxamide. InChIKey: ZUSYYGDWLGXDSL-UHFFFAOYSA-O.

Identity
Molecular formulaC7H9N2O+
Molecular weight137.16 g/mol
IUPAC name1-methylpyridin-1-ium-2-carboxamide
InChIKeyZUSYYGDWLGXDSL-UHFFFAOYSA-O
SMILESC[N+]1=CC=CC=C1C(=O)N

Computed by PubChem (NCBI)