CAS 457641-35-9 is the registry number for 2-({6-Phenylthieno(2,3-d)pyrimidin-4-yl}sulfanyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetic acid (CAS 457641-35-9) is a chemical compound with the molecular formula C14H10N2O2S2 and a molecular weight of 302.4 g/mol. IUPAC name: 2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetic acid. InChIKey: CLMDSUMBQJGJOH-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2S2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetic acid |
| InChIKey | CLMDSUMBQJGJOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)N=CN=C3SCC(=O)O |
Computed by PubChem (NCBI)