Products 457891-24-6

CAS 457891-24-6 is the registry number for 3-Bromo-2h-indazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 100g, 25g.

Structural formula: {0} (CAS {1})

3-bromo-2H-indazole (CAS 457891-24-6) is a chemical compound with the molecular formula C7H5BrN2 and a molecular weight of 197.03 g/mol. IUPAC name: 3-bromo-2H-indazole. InChIKey: HTKXRTUKPXEALT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrN2
Molecular weight197.03 g/mol
IUPAC name3-bromo-2H-indazole
InChIKeyHTKXRTUKPXEALT-UHFFFAOYSA-N
SMILESC1=CC2=C(NN=C2C=C1)Br

Computed by PubChem (NCBI)