CAS 45893-20-7 appears in our catalog under these names: Mercaptopurine Impurity 7, 8-Aminohypoxanthine, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
8-amino-1,7-dihydropurin-6-one (CAS 45893-20-7) is a chemical compound with the molecular formula C5H5N5O and a molecular weight of 151.13 g/mol. IUPAC name: 8-amino-1,7-dihydropurin-6-one. InChIKey: NVDXOOZGKFFGDJ-UHFFFAOYSA-N.
| Molecular formula | C5H5N5O |
|---|---|
| Molecular weight | 151.13 g/mol |
| IUPAC name | 8-amino-1,7-dihydropurin-6-one |
| InChIKey | NVDXOOZGKFFGDJ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)N1)NC(=N2)N |
Computed by PubChem (NCBI)