CAS 4590-24-3 appears in our catalog under these names: Dimethyl hexadecafluorosebacate, 95%, Dimethylperfluorosebacate, 97%, Dimethyl hexadecafluorosebacate, ≥98%, ≥98%, Dimethyl hexadecafluorosebacate. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g.
Dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioate (CAS 4590-24-3) is a chemical compound with the molecular formula C12H6F16O4 and a molecular weight of 518.15 g/mol. IUPAC name: dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioate. InChIKey: VZHNQOSVLFDCLH-UHFFFAOYSA-N.
| Molecular formula | C12H6F16O4 |
|---|---|
| Molecular weight | 518.15 g/mol |
| IUPAC name | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioate |
| InChIKey | VZHNQOSVLFDCLH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(C(C(C(C(C(C(=O)OC)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)