Products 459168-97-9
CAS 459168-97-9 appears in our catalog under these names: MJN228, MJN228, 99.30%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 1 mg.
(4-methylpiperazin-1-yl)-(5-nitro-3-phenyl-1H-indol-2-yl)methanone (CAS 459168-97-9) is a chemical compound with the molecular formula C20H20N4O3 and a molecular weight of 364.4 g/mol. IUPAC name: (4-methylpiperazin-1-yl)-(5-nitro-3-phenyl-1H-indol-2-yl)methanone. InChIKey: BLSWPPPBUQFKHH-UHFFFAOYSA-N.
| Molecular formula | C20H20N4O3 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (4-methylpiperazin-1-yl)-(5-nitro-3-phenyl-1H-indol-2-yl)methanone |
| InChIKey | BLSWPPPBUQFKHH-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=C(C3=C(N2)C=CC(=C3)[N+](=O)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)