CAS 459419-20-6 is the registry number for 3-(2,5-Dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)-4H-chromen-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,5-dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one (CAS 459419-20-6) is a chemical compound with the molecular formula C18H13F3O4 and a molecular weight of 350.3 g/mol. IUPAC name: 3-(2,5-dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one. InChIKey: NJVTVEKACHIZIK-UHFFFAOYSA-N.
| Molecular formula | C18H13F3O4 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 3-(2,5-dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| InChIKey | NJVTVEKACHIZIK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OC2=C(OC3=C(C2=O)C=CC(=C3)O)C(F)(F)F |
Computed by PubChem (NCBI)