Products 45946-64-3

CAS 45946-64-3 is the registry number for 5-Vinylpicolinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-ethenylpyridine-2-carboxylic acid (CAS 45946-64-3) is a chemical compound with the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. IUPAC name: 5-ethenylpyridine-2-carboxylic acid. InChIKey: ADRIIDWWYDDLIH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO2
Molecular weight149.15 g/mol
IUPAC name5-ethenylpyridine-2-carboxylic acid
InChIKeyADRIIDWWYDDLIH-UHFFFAOYSA-N
SMILESC=CC1=CN=C(C=C1)C(=O)O

Computed by PubChem (NCBI)