Products 4596-38-7

CAS 4596-38-7 appears in our catalog under these names: 3-(2-Chloroacetamido)propanoic acid, 95%, 3–(2–chloroacetamido)propanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-[(2-chloroacetyl)amino]propanoic acid (CAS 4596-38-7) is a chemical compound with the molecular formula C5H8ClNO3 and a molecular weight of 165.57 g/mol. IUPAC name: 3-[(2-chloroacetyl)amino]propanoic acid. InChIKey: BEJUGFDJTBNLPO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClNO3
Molecular weight165.57 g/mol
IUPAC name3-[(2-chloroacetyl)amino]propanoic acid
InChIKeyBEJUGFDJTBNLPO-UHFFFAOYSA-N
SMILESC(CNC(=O)CCl)C(=O)O

Computed by PubChem (NCBI)