CAS 459817-82-4 appears in our catalog under these names: tert-Butyl 1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, tert-Butyl 1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide 98%, tert-Butyl 1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 95%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 50g, 5g, 1g, 10g, 25g, 100g, 500g.
Tert-butyl 2,2-dioxooxathiazolidine-3-carboxylate (CAS 459817-82-4) is a chemical compound with the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. IUPAC name: tert-butyl 2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: ALJRPIAYJALVFG-UHFFFAOYSA-N.
| Molecular formula | C7H13NO5S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | tert-butyl 2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | ALJRPIAYJALVFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOS1(=O)=O |
Computed by PubChem (NCBI)