CAS 460096-08-6 is the registry number for Tin bis(trifluoromethylsulfonyl)imide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(bis(trifluoromethylsulfonyl)azanide);tin(2+) (CAS 460096-08-6) is a chemical compound with the molecular formula C4F12N2O8S4Sn and a molecular weight of 679.0 g/mol. IUPAC name: bis(bis(trifluoromethylsulfonyl)azanide);tin(2+). InChIKey: QPQBLPURKYVWME-UHFFFAOYSA-N.
| Molecular formula | C4F12N2O8S4Sn |
|---|---|
| Molecular weight | 679.0 g/mol |
| IUPAC name | bis(bis(trifluoromethylsulfonyl)azanide);tin(2+) |
| InChIKey | QPQBLPURKYVWME-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Sn+2] |
Computed by PubChem (NCBI)