CAS 4607-22-1 is the registry number for D-glucosamine 2-sulfate. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid (CAS 4607-22-1) is a chemical compound with the molecular formula C6H13NO8S and a molecular weight of 259.24 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid. InChIKey: KZWHEHSUEBTKJM-SLPGGIOYSA-N.
| Molecular formula | C6H13NO8S |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid |
| InChIKey | KZWHEHSUEBTKJM-SLPGGIOYSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)NS(=O)(=O)O)O)O)O)O |
Computed by PubChem (NCBI)